C12H13N5OS2 — CID 135439718
N'-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate (PubChem CID 135439718) has the molecular formula C12H13N5OS2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N'-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate.
| Compound Name | N'-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 135439718 |
| Molecular Formula | C12H13N5OS2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N'-[(E)-[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate |
| SMILES | Cc1cc(C)c[n+](-c2[nH]c(=O)sc2/C=N/N=C(\N)[S-])c1 |
| InChI | InChI=1S/C12H13N5OS2/c1-7-3-8(2)6-17(5-7)10-9(20-12(18)15-10)4-14-16-11(13)19/h3-6H,1-2H3,(H3-,13,14,15,16,18,19) |
| InChIKey | PWPSDEPXHIBYJL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|