About 3-anilino-4H-1,2,4-triazin-5-one
3-anilino-4H-1,2,4-triazin-5-one (PubChem CID 135439726) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-anilino-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-anilino-4H-1,2,4-triazin-5-one |
| PubChem CID | 135439726 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-anilino-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C9H8N4O/c14-8-6-10-13-9(12-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14) |
| InChIKey | XJANMFIZMSJZEJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-anilino-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-4H-1,2,4-triazin-5-one?
The IUPAC name of 3-anilino-4H-1,2,4-triazin-5-one (CID 135439726) is 3-anilino-4H-1,2,4-triazin-5-one.
What is the SMILES notation for 3-anilino-4H-1,2,4-triazin-5-one?
The canonical SMILES for 3-anilino-4H-1,2,4-triazin-5-one is O=c1cnnc(Nc2ccccc2)[nH]1.
What is the InChIKey of 3-anilino-4H-1,2,4-triazin-5-one?
The InChIKey is XJANMFIZMSJZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c14-8-6-10-13-9(12-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14).
What are the key properties of 3-anilino-4H-1,2,4-triazin-5-one?
3-anilino-4H-1,2,4-triazin-5-one has a molecular weight of 188.19 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 135439726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).