About 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride
5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 135439769) has the molecular formula C6H10ClN3O
and a molecular weight of 175.62 g/mol. Its IUPAC name is 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride |
| PubChem CID | 135439769 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | Cc1nc(C)c(N)c(=O)[nH]1.Cl |
| InChI | InChI=1S/C6H9N3O.ClH/c1-3-5(7)6(10)9-4(2)8-3;/h7H2,1-2H3,(H,8,9,10);1H |
| InChIKey | CNYQWFCYICVJOG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride?
The IUPAC name of 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride (CID 135439769) is 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride.
What is the SMILES notation for 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride?
The canonical SMILES for 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride is Cc1nc(C)c(N)c(=O)[nH]1.Cl.
What is the InChIKey of 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride?
The InChIKey is CNYQWFCYICVJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.ClH/c1-3-5(7)6(10)9-4(2)8-3;/h7H2,1-2H3,(H,8,9,10);1H.
What are the key properties of 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride?
5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride has a molecular weight of 175.62 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dimethyl-1H-pyrimidin-6-one;hydrochloride is sourced from PubChem (CID 135439769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).