C16H12N2O5S — CID 135439790
4-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzenesulfonamide (PubChem CID 135439790) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135439790 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 4-[(4-hydroxy-2-oxochromen-3-yl)methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/c2c(O)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C16H12N2O5S/c17-24(21,22)11-7-5-10(6-8-11)18-9-13-15(19)12-3-1-2-4-14(12)23-16(13)20/h1-9,19H,(H2,17,21,22)/b18-9+ |
| InChIKey | HBZKDACXEUYMBM-GIJQJNRQSA-N |
| XLogP | 1.90 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|