C15H15N5O3S2 — CID 135439793
N-(4-methylphenyl)-2-[(2E)-4-oxo-2-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135439793) has the molecular formula C15H15N5O3S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(2E)-4-oxo-2-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(2E)-4-oxo-2-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135439793 |
| Molecular Formula | C15H15N5O3S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-(4-methylphenyl)-2-[(2E)-4-oxo-2-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CC2S/C(=N/N=C3/NC(=O)CS3)NC2=O)cc1 |
| InChI | InChI=1S/C15H15N5O3S2/c1-8-2-4-9(5-3-8)16-11(21)6-10-13(23)18-15(25-10)20-19-14-17-12(22)7-24-14/h2-5,10H,6-7H2,1H3,(H,16,21)(H,17,19,22)(H,18,20,23) |
| InChIKey | PSIKZZGNDKKLEL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|