C22H26N4O4S — CID 135439831
1-[3-[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]propyl]pyrrolidin-2-one (PubChem CID 135439831) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[3-[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135439831 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[3-[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-hydroxy-5-imino-2H-pyrrol-1-yl]propyl]pyrrolidin-2-one |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(OC)c(OC)c3)cs2)=C(O)CN1CCCN1CCCC1=O |
| InChI | InChI=1S/C22H26N4O4S/c1-29-17-7-6-14(11-18(17)30-2)15-13-31-22(24-15)20-16(27)12-26(21(20)23)10-4-9-25-8-3-5-19(25)28/h6-7,11,13,23,27H,3-5,8-10,12H2,1-2H3/b23-21- |
| InChIKey | JYHOHFPCMMDLNZ-LNVKXUELSA-N |
| XLogP | 3.40 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|