C15H21N3S — CID 135439853
N-butyl-5-(3,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135439853) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is N-butyl-5-(3,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-butyl-5-(3,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135439853 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-butyl-5-(3,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCCC/N=C1/NN=C(c2ccc(C)c(C)c2)CS1 |
| InChI | InChI=1S/C15H21N3S/c1-4-5-8-16-15-18-17-14(10-19-15)13-7-6-11(2)12(3)9-13/h6-7,9H,4-5,8,10H2,1-3H3,(H,16,18) |
| InChIKey | RSCOMAGDKYXTQS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|