C22H23N5OS — CID 135439857
4-[[5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 135439857) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 4-[[5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 135439857 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-[[5-(4-ethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCc1ccc(C2=NN/C(=N/c3c(C)n(C)n(-c4ccccc4)c3=O)SC2)cc1 |
| InChI | InChI=1S/C22H23N5OS/c1-4-16-10-12-17(13-11-16)19-14-29-22(25-24-19)23-20-15(2)26(3)27(21(20)28)18-8-6-5-7-9-18/h5-13H,4,14H2,1-3H3,(H,23,25) |
| InChIKey | ZVMVFJRKJZOBSP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|