About 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea
1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea (PubChem CID 135439873) has the molecular formula C24H26N6O2
and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea |
| PubChem CID | 135439873 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea |
| SMILES | Cc1c(/N=C2\N=C(NC(=O)NC(C)(C)C)c3ccccc32)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H26N6O2/c1-15-19(22(31)30(29(15)5)16-11-7-6-8-12-16)25-20-17-13-9-10-14-18(17)21(26-20)27-23(32)28-24(2,3)4/h6-14H,1-5H3,(H2,25,26,27,28,32) |
| InChIKey | GZAZHLCGXXKZDH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea?
The IUPAC name of 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea (CID 135439873) is 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea.
What is the SMILES notation for 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea?
The canonical SMILES for 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea is Cc1c(/N=C2\N=C(NC(=O)NC(C)(C)C)c3ccccc32)c(=O)n(-c2ccccc2)n1C.
What is the InChIKey of 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea?
The InChIKey is GZAZHLCGXXKZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N6O2/c1-15-19(22(31)30(29(15)5)16-11-7-6-8-12-16)25-20-17-13-9-10-14-18(17)21(26-20)27-23(32)28-24(2,3)4/h6-14H,1-5H3,(H2,25,26,27,28,32).
What are the key properties of 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea?
1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea has a molecular weight of 430.51 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminoisoindol-1-yl]urea is sourced from PubChem (CID 135439873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).