C16H15N3S — CID 135439878
N-benzyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135439878) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-benzyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-benzyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135439878 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-benzyl-5-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | c1ccc(C/N=C2/NN=C(c3ccccc3)CS2)cc1 |
| InChI | InChI=1S/C16H15N3S/c1-3-7-13(8-4-1)11-17-16-19-18-15(12-20-16)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19) |
| InChIKey | FFRGYUHOYHQMTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|