C16H18N4S — CID 135439907
N-phenyl-5-(1,2,5-trimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135439907) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-phenyl-5-(1,2,5-trimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-phenyl-5-(1,2,5-trimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135439907 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-phenyl-5-(1,2,5-trimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/c3ccccc3)SC2)c(C)n1C |
| InChI | InChI=1S/C16H18N4S/c1-11-9-14(12(2)20(11)3)15-10-21-16(19-18-15)17-13-7-5-4-6-8-13/h4-9H,10H2,1-3H3,(H,17,19) |
| InChIKey | VPKQZDQIXQRTNN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|