About 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea
1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea (PubChem CID 135440007) has the molecular formula C12H16N6S
and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea.
Molecular Properties
| Compound Name | 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea |
| PubChem CID | 135440007 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea |
| SMILES | C/C(=N\NC(=S)NC(C)C)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C12H16N6S/c1-7(2)14-12(19)18-17-8(3)10-15-9-5-4-6-13-11(9)16-10/h4-7H,1-3H3,(H,13,15,16)(H2,14,18,19)/b17-8+ |
| InChIKey | WRTPYTYTESWSSN-CAOOACKPSA-N |
| XLogP | 1.55 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea?
The IUPAC name of 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea (CID 135440007) is 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea.
What is the SMILES notation for 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea?
The canonical SMILES for 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea is C/C(=N\NC(=S)NC(C)C)c1nc2ncccc2[nH]1.
What is the InChIKey of 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea?
The InChIKey is WRTPYTYTESWSSN-CAOOACKPSA-N. The full InChI is InChI=1S/C12H16N6S/c1-7(2)14-12(19)18-17-8(3)10-15-9-5-4-6-13-11(9)16-10/h4-7H,1-3H3,(H,13,15,16)(H2,14,18,19)/b17-8+.
What are the key properties of 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea?
1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea has a molecular weight of 276.37 g/mol, XLogP of 1.55, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1-(1H-imidazo[4,5-b]pyridin-2-yl)ethylideneamino]-3-propan-2-ylthiourea is sourced from PubChem (CID 135440007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).