C13H10F3N5O — CID 135440029
2-[3-(2,2,2-trifluoroethyl)anilino]-1,7-dihydropurin-6-one (PubChem CID 135440029) has the molecular formula C13H10F3N5O and a molecular weight of 309.25 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethyl)anilino]-1,7-dihydropurin-6-one.
| Compound Name | 2-[3-(2,2,2-trifluoroethyl)anilino]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135440029 |
| Molecular Formula | C13H10F3N5O |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethyl)anilino]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(Nc2cccc(CC(F)(F)F)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H10F3N5O/c14-13(15,16)5-7-2-1-3-8(4-7)19-12-20-10-9(11(22)21-12)17-6-18-10/h1-4,6H,5H2,(H3,17,18,19,20,21,22) |
| InChIKey | LYMSMIVPXNLRNH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |