C25H20N6O3 — CID 135440157
(E)-N-[(E)-[5-(5,7-dimethyl-3-phenyl-1H-indol-2-yl)-1H-pyrazol-4-yl]methylideneamino]-1-(5-nitrofuran-2-yl)methanimine (PubChem CID 135440157) has the molecular formula C25H20N6O3 and a molecular weight of 452.47 g/mol. Its IUPAC name is (E)-N-[(E)-[5-(5,7-dimethyl-3-phenyl-1H-indol-2-yl)-1H-pyrazol-4-yl]methylideneamino]-1-(5-nitrofuran-2-yl)methanimine.
| Compound Name | (E)-N-[(E)-[5-(5,7-dimethyl-3-phenyl-1H-indol-2-yl)-1H-pyrazol-4-yl]methylideneamino]-1-(5-nitrofuran-2-yl)methanimine |
|---|---|
| PubChem CID | 135440157 |
| Molecular Formula | C25H20N6O3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (E)-N-[(E)-[5-(5,7-dimethyl-3-phenyl-1H-indol-2-yl)-1H-pyrazol-4-yl]methylideneamino]-1-(5-nitrofuran-2-yl)methanimine |
| SMILES | Cc1cc(C)c2[nH]c(-c3[nH]ncc3/C=N/N=C/c3ccc([N+](=O)[O-])o3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H20N6O3/c1-15-10-16(2)23-20(11-15)22(17-6-4-3-5-7-17)25(29-23)24-18(13-28-30-24)12-26-27-14-19-8-9-21(34-19)31(32)33/h3-14,29H,1-2H3,(H,28,30)/b26-12+,27-14+ |
| InChIKey | KJIXSKGNUDUNDL-DKIJSDHTSA-N |
| XLogP | 5.80 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|