C48H38N4 — CID 135440475
5,10,15,20-tetrakis(3-methylphenyl)-21,23-dihydroporphyrin (PubChem CID 135440475) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3-methylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3-methylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135440475 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 5,10,15,20-tetrakis(3-methylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cccc(-c2c3nc(c(-c4cccc(C)c4)c4ccc([nH]4)c(-c4cccc(C)c4)c4nc(c(-c5cccc(C)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C48H38N4/c1-29-9-5-13-33(25-29)45-37-17-19-39(49-37)46(34-14-6-10-30(2)26-34)41-21-23-43(51-41)48(36-16-8-12-32(4)28-36)44-24-22-42(52-44)47(40-20-18-38(45)50-40)35-15-7-11-31(3)27-35/h5-28,49,52H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | VTJYAROBIDZWEY-PJEPRTEXSA-N |
| XLogP | 12.56 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |