About 2-amino-7,8-dihydro-3H-pteridin-4-one
2-amino-7,8-dihydro-3H-pteridin-4-one (PubChem CID 135440520) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 2-amino-7,8-dihydro-3H-pteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-7,8-dihydro-3H-pteridin-4-one |
| PubChem CID | 135440520 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-amino-7,8-dihydro-3H-pteridin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N=CCN2 |
| InChI | InChI=1S/C6H7N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1H,2H2,(H4,7,9,10,11,12) |
| InChIKey | PXZWKVIXSKSCFR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-7,8-dihydro-3H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8-dihydro-3H-pteridin-4-one?
The IUPAC name of 2-amino-7,8-dihydro-3H-pteridin-4-one (CID 135440520) is 2-amino-7,8-dihydro-3H-pteridin-4-one.
What is the SMILES notation for 2-amino-7,8-dihydro-3H-pteridin-4-one?
The canonical SMILES for 2-amino-7,8-dihydro-3H-pteridin-4-one is Nc1nc2c(c(=O)[nH]1)N=CCN2.
What is the InChIKey of 2-amino-7,8-dihydro-3H-pteridin-4-one?
The InChIKey is PXZWKVIXSKSCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1H,2H2,(H4,7,9,10,11,12).
What are the key properties of 2-amino-7,8-dihydro-3H-pteridin-4-one?
2-amino-7,8-dihydro-3H-pteridin-4-one has a molecular weight of 165.16 g/mol, XLogP of -0.52, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8-dihydro-3H-pteridin-4-one is sourced from PubChem (CID 135440520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).