About methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate
methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate (PubChem CID 135441065) has the molecular formula C14H19NO5
and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate |
| PubChem CID | 135441065 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate |
| SMILES | C=CCO/N=C/C1=C(O)C(C(=O)OC)C(C)(C)CC1=O |
| InChI | InChI=1S/C14H19NO5/c1-5-6-20-15-8-9-10(16)7-14(2,3)11(12(9)17)13(18)19-4/h5,8,11,17H,1,6-7H2,2-4H3/b15-8+ |
| InChIKey | RSSCJKWRXIKDNE-OVCLIPMQSA-N |
| XLogP | 1.78 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate (CID 135441065) is methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate is C=CCO/N=C/C1=C(O)C(C(=O)OC)C(C)(C)CC1=O.
What is the InChIKey of methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate?
The InChIKey is RSSCJKWRXIKDNE-OVCLIPMQSA-N. The full InChI is InChI=1S/C14H19NO5/c1-5-6-20-15-8-9-10(16)7-14(2,3)11(12(9)17)13(18)19-4/h5,8,11,17H,1,6-7H2,2-4H3/b15-8+.
What are the key properties of methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate?
methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate has a molecular weight of 281.31 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-6,6-dimethyl-4-oxo-3-[(E)-prop-2-enoxyiminomethyl]cyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 135441065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).