About (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile (PubChem CID 135441103) has the molecular formula C17H12N2O2S
and a molecular weight of 308.36 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile |
| PubChem CID | 135441103 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)COc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12N2O2S/c18-10-13(15(20)11-21-12-6-2-1-3-7-12)17-19-14-8-4-5-9-16(14)22-17/h1-9,20H,11H2/b15-13- |
| InChIKey | PZQDXJDKTYRXMJ-SQFISAMPSA-N |
| XLogP | 4.17 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile?
The IUPAC name of (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile (CID 135441103) is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile.
What is the SMILES notation for (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile?
The canonical SMILES for (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile is N#C/C(=C(/O)COc1ccccc1)c1nc2ccccc2s1.
What is the InChIKey of (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile?
The InChIKey is PZQDXJDKTYRXMJ-SQFISAMPSA-N. The full InChI is InChI=1S/C17H12N2O2S/c18-10-13(15(20)11-21-12-6-2-1-3-7-12)17-19-14-8-4-5-9-16(14)22-17/h1-9,20H,11H2/b15-13-.
What are the key properties of (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile?
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile has a molecular weight of 308.36 g/mol, XLogP of 4.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-phenoxybut-2-enenitrile is sourced from PubChem (CID 135441103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).