C23H27N3O2S — CID 135441142
(5E)-5-[(4-octoxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 135441142) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is (5E)-5-[(4-octoxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-octoxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135441142 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (5E)-5-[(4-octoxyphenyl)methylidene]-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCOc1ccc(/C=C2/S/C(=N\c3cccnc3)NC2=O)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-2-3-4-5-6-7-15-28-20-12-10-18(11-13-20)16-21-22(27)26-23(29-21)25-19-9-8-14-24-17-19/h8-14,16-17H,2-7,15H2,1H3,(H,25,26,27)/b21-16+ |
| InChIKey | JHGVJRIBVWUOGT-LTGZKZEYSA-N |
| XLogP | 5.71 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|