About ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate
ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate (PubChem CID 135441508) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate.
Analyze ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate?
The IUPAC name of ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate (CID 135441508) is ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate.
What is the SMILES notation for ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate?
The canonical SMILES for ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate is CCOC(=O)c1cnn2c(=O)[nH]cnc12.
What is the InChIKey of ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate?
The InChIKey is SYLJDCNFBSSQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c1-2-15-7(13)5-3-11-12-6(5)9-4-10-8(12)14/h3-4H,2H2,1H3,(H,9,10,14).
What are the key properties of ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate?
ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate has a molecular weight of 208.18 g/mol, XLogP of -0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylate is sourced from PubChem (CID 135441508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).