C19H17NO4 — CID 135441618
2-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one (PubChem CID 135441618) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one.
| Compound Name | 2-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 135441618 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[N-(2,4-dimethoxyphenyl)-C-methylcarbonimidoyl]-3-hydroxyinden-1-one |
| SMILES | COc1ccc(/N=C(\C)C2=C(O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H17NO4/c1-11(20-15-9-8-12(23-2)10-16(15)24-3)17-18(21)13-6-4-5-7-14(13)19(17)22/h4-10,21H,1-3H3/b20-11+ |
| InChIKey | KBNMRCPHUPAEAP-RGVLZGJSSA-N |
| XLogP | 3.96 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|