C19H29N5O6S — CID 135442124
(4R,5S,6R)-3-[(3S,5R)-5-[(2Z)-2-(dimethylcarbamoylamino)-2-hydroxyiminoethyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 135442124) has the molecular formula C19H29N5O6S and a molecular weight of 455.54 g/mol. Its IUPAC name is (4R,5S,6R)-3-[(3S,5R)-5-[(2Z)-2-(dimethylcarbamoylamino)-2-hydroxyiminoethyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6R)-3-[(3S,5R)-5-[(2Z)-2-(dimethylcarbamoylamino)-2-hydroxyiminoethyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 135442124 |
| Molecular Formula | C19H29N5O6S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (4R,5S,6R)-3-[(3S,5R)-5-[(2Z)-2-(dimethylcarbamoylamino)-2-hydroxyiminoethyl]pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](C/C(=N/O)NC(=O)N(C)C)C3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C19H29N5O6S/c1-8-14-13(9(2)25)17(26)24(14)15(18(27)28)16(8)31-11-5-10(20-7-11)6-12(22-30)21-19(29)23(3)4/h8-11,13-14,20,25,30H,5-7H2,1-4H3,(H,27,28)(H,21,22,29)/t8-,9-,10+,11+,13+,14-/m1/s1 |
| InChIKey | OYTSHCBYYPHBBH-NYNZDRAESA-N |
| XLogP | 0.05 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|