C13H13F3N2O3 — CID 135442271
6,7-diethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 135442271) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 6,7-diethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6,7-diethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135442271 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6,7-diethoxy-2-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CCOc1cc2nc(C(F)(F)F)[nH]c(=O)c2cc1OCC |
| InChI | InChI=1S/C13H13F3N2O3/c1-3-20-9-5-7-8(6-10(9)21-4-2)17-12(13(14,15)16)18-11(7)19/h5-6H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | WMYHOJVUPYRSCK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |