C14H14N2O2 — CID 135442372
2-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 135442372) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135442372 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2O)nc2c1CCCC2 |
| InChI | InChI=1S/C14H14N2O2/c17-12-8-4-2-6-10(12)13-15-11-7-3-1-5-9(11)14(18)16-13/h2,4,6,8,17H,1,3,5,7H2,(H,15,16,18) |
| InChIKey | HJRGCXWTEOVKLE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |