About 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate
2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate (PubChem CID 135442757) has the molecular formula C18H18N2O5S
and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate.
Molecular Properties
| Compound Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate |
| PubChem CID | 135442757 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate |
| SMILES | O=C(OCCOCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O5S/c21-18(14-6-2-1-3-7-14)25-13-12-24-11-10-19-17-15-8-4-5-9-16(15)26(22,23)20-17/h1-9H,10-13H2,(H,19,20) |
| InChIKey | PVMPJPHIMGLJOL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate?
The IUPAC name of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate (CID 135442757) is 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate.
What is the SMILES notation for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate?
The canonical SMILES for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate is O=C(OCCOCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1.
What is the InChIKey of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate?
The InChIKey is PVMPJPHIMGLJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O5S/c21-18(14-6-2-1-3-7-14)25-13-12-24-11-10-19-17-15-8-4-5-9-16(15)26(22,23)20-17/h1-9H,10-13H2,(H,19,20).
What are the key properties of 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate?
2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate has a molecular weight of 374.42 g/mol, XLogP of 1.60, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethoxy]ethyl benzoate is sourced from PubChem (CID 135442757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).