About 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one
4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one (PubChem CID 135443392) has the molecular formula C5H4N4OS
and a molecular weight of 168.18 g/mol. Its IUPAC name is 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one |
| PubChem CID | 135443392 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one |
| SMILES | O=c1[nH]c(=S)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C5H4N4OS/c10-5-7-3-2(1-6-9-3)4(11)8-5/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | KDAAPQIIYTZQEZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one?
The IUPAC name of 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one (CID 135443392) is 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one.
What is the SMILES notation for 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one?
The canonical SMILES for 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one is O=c1[nH]c(=S)c2cn[nH]c2[nH]1.
What is the InChIKey of 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one?
The InChIKey is KDAAPQIIYTZQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4OS/c10-5-7-3-2(1-6-9-3)4(11)8-5/h1H,(H3,6,7,8,9,10,11).
What are the key properties of 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one?
4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one has a molecular weight of 168.18 g/mol, XLogP of 0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylidene-1,7-dihydropyrazolo[5,4-d]pyrimidin-6-one is sourced from PubChem (CID 135443392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).