C11H14ClN3O2S — CID 135443492
N-tert-butyl-7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135443492) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is N-tert-butyl-7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-tert-butyl-7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135443492 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-tert-butyl-7-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(C)(C)/N=C1\Nc2ccc(Cl)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C11H14ClN3O2S/c1-11(2,3)14-10-13-8-5-4-7(12)6-9(8)18(16,17)15-10/h4-6H,1-3H3,(H2,13,14,15) |
| InChIKey | NPFSOWHUNNYVIL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|