C17H14ClN5 — CID 135444580
5-(2-chlorophenyl)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-7-amine (PubChem CID 135444580) has the molecular formula C17H14ClN5 and a molecular weight of 323.79 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-7-amine.
| Compound Name | 5-(2-chlorophenyl)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-7-amine |
|---|---|
| PubChem CID | 135444580 |
| Molecular Formula | C17H14ClN5 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-(2-chlorophenyl)-3-methyl-2,10-dihydropyrazolo[3,4-b][1,4]benzodiazepin-7-amine |
| SMILES | Cc1[nH]nc2c1N=C(c1ccccc1Cl)c1cc(N)ccc1N2 |
| InChI | InChI=1S/C17H14ClN5/c1-9-15-17(23-22-9)20-14-7-6-10(19)8-12(14)16(21-15)11-4-2-3-5-13(11)18/h2-8H,19H2,1H3,(H2,20,22,23) |
| InChIKey | KOQSEURLFTUQRS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|