About (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one
(4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 135444712) has the molecular formula C14H8Br2N4O2
and a molecular weight of 424.05 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| PubChem CID | 135444712 |
| Molecular Formula | C14H8Br2N4O2 |
| Molecular Weight | 424.05 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | O=C1NN=C(c2cnccn2)/C1=C/c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H8Br2N4O2/c15-9-4-7(5-10(16)13(9)21)3-8-12(19-20-14(8)22)11-6-17-1-2-18-11/h1-6,21H,(H,20,22)/b8-3- |
| InChIKey | FYWPTZQFJKTGTF-BAQGIRSFSA-N |
| XLogP | 2.62 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.05 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The IUPAC name of (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (CID 135444712) is (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
What is the SMILES notation for (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The canonical SMILES for (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one is O=C1NN=C(c2cnccn2)/C1=C/c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
The InChIKey is FYWPTZQFJKTGTF-BAQGIRSFSA-N. The full InChI is InChI=1S/C14H8Br2N4O2/c15-9-4-7(5-10(16)13(9)21)3-8-12(19-20-14(8)22)11-6-17-1-2-18-11/h1-6,21H,(H,20,22)/b8-3-.
What are the key properties of (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one?
(4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one has a molecular weight of 424.05 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one is sourced from PubChem (CID 135444712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).