C23H22N4O4S — CID 135444752
1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1,8-naphthyridin-2-one (PubChem CID 135444752) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1,8-naphthyridin-2-one.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 135444752 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-hydroxy-1,8-naphthyridin-2-one |
| SMILES | O=c1c(C2=NS(=O)(=O)c3ccccc3N2)c(O)c2cccnc2n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H22N4O4S/c28-20-16-9-6-13-24-22(16)27(14-12-15-7-2-1-3-8-15)23(29)19(20)21-25-17-10-4-5-11-18(17)32(30,31)26-21/h4-7,9-11,13,28H,1-3,8,12,14H2,(H,25,26) |
| InChIKey | KXDVYPJKNVNCME-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|