C14H14N3O11PS2 — CID 135444796
2-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzene-1,4-disulfonic acid (PubChem CID 135444796) has the molecular formula C14H14N3O11PS2 and a molecular weight of 495.38 g/mol. Its IUPAC name is 2-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 135444796 |
| Molecular Formula | C14H14N3O11PS2 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 2-[(3,9-dihydroxy-8-methyl-3-oxo-1,5-dihydro-[1,3,2]dioxaphosphepino[5,6-c]pyridin-6-yl)diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Cc1nc(/N=N/c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)c2c(c1O)COP(=O)(O)OC2 |
| InChI | InChI=1S/C14H14N3O11PS2/c1-7-13(18)9-5-27-29(19,20)28-6-10(9)14(15-7)17-16-11-4-8(30(21,22)23)2-3-12(11)31(24,25)26/h2-4,18H,5-6H2,1H3,(H,19,20)(H,21,22,23)(H,24,25,26)/b17-16+ |
| InChIKey | GGJCEYXTBFQGRQ-WUKNDPDISA-N |
| XLogP | 2.15 |
| TPSA | 222.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|