C9H6N4O — CID 135445032
2,5-dihydro-[1,2,4]triazino[5,6-b]indol-3-one (PubChem CID 135445032) has the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. Its IUPAC name is 2,5-dihydro-[1,2,4]triazino[5,6-b]indol-3-one.
| Compound Name | 2,5-dihydro-[1,2,4]triazino[5,6-b]indol-3-one |
|---|---|
| PubChem CID | 135445032 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2,5-dihydro-[1,2,4]triazino[5,6-b]indol-3-one |
| SMILES | O=c1nc2[nH]c3ccccc3c2n[nH]1 |
| InChI | InChI=1S/C9H6N4O/c14-9-11-8-7(12-13-9)5-3-1-2-4-6(5)10-8/h1-4H,(H2,10,11,13,14) |
| InChIKey | VQTUJBNRPWJORO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |