C11H13N3O4 — CID 135445347
methyl (Z)-2-(2-acetamidopyrimidin-4-yl)-3-hydroxybut-2-enoate (PubChem CID 135445347) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl (Z)-2-(2-acetamidopyrimidin-4-yl)-3-hydroxybut-2-enoate.
| Compound Name | methyl (Z)-2-(2-acetamidopyrimidin-4-yl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135445347 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl (Z)-2-(2-acetamidopyrimidin-4-yl)-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(=C(/C)O)c1ccnc(NC(C)=O)n1 |
| InChI | InChI=1S/C11H13N3O4/c1-6(15)9(10(17)18-3)8-4-5-12-11(14-8)13-7(2)16/h4-5,15H,1-3H3,(H,12,13,14,16)/b9-6- |
| InChIKey | AFGCVVRELKGNKO-TWGQIWQCSA-N |
| XLogP | 0.90 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|