About 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol
2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol (PubChem CID 135445374) has the molecular formula C16H10N2O3S
and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol |
| PubChem CID | 135445374 |
| Molecular Formula | C16H10N2O3S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol |
| SMILES | Oc1ccc(-c2nc3cc(O)cc(-c4nccs4)c3o2)cc1 |
| InChI | InChI=1S/C16H10N2O3S/c19-10-3-1-9(2-4-10)15-18-13-8-11(20)7-12(14(13)21-15)16-17-5-6-22-16/h1-8,19-20H |
| InChIKey | OXLPXIPFCLXQSY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol?
The IUPAC name of 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol (CID 135445374) is 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol.
What is the SMILES notation for 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol?
The canonical SMILES for 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol is Oc1ccc(-c2nc3cc(O)cc(-c4nccs4)c3o2)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol?
The InChIKey is OXLPXIPFCLXQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O3S/c19-10-3-1-9(2-4-10)15-18-13-8-11(20)7-12(14(13)21-15)16-17-5-6-22-16/h1-8,19-20H.
What are the key properties of 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol?
2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol has a molecular weight of 310.33 g/mol, XLogP of 4.03, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-ol is sourced from PubChem (CID 135445374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).