About 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea
3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea (PubChem CID 135445518) has the molecular formula C13H17Cl2N3OS
and a molecular weight of 334.27 g/mol. Its IUPAC name is 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea.
Molecular Properties
| Compound Name | 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea |
| PubChem CID | 135445518 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea |
| SMILES | CN(/N=C/c1cc(Cl)cc(Cl)c1O)C(=S)NC(C)(C)C |
| InChI | InChI=1S/C13H17Cl2N3OS/c1-13(2,3)17-12(20)18(4)16-7-8-5-9(14)6-10(15)11(8)19/h5-7,19H,1-4H3,(H,17,20)/b16-7+ |
| InChIKey | ADJHAOREQGPZCH-FRKPEAEDSA-N |
| XLogP | 3.64 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea?
The IUPAC name of 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea (CID 135445518) is 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea.
What is the SMILES notation for 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea?
The canonical SMILES for 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea is CN(/N=C/c1cc(Cl)cc(Cl)c1O)C(=S)NC(C)(C)C.
What is the InChIKey of 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea?
The InChIKey is ADJHAOREQGPZCH-FRKPEAEDSA-N. The full InChI is InChI=1S/C13H17Cl2N3OS/c1-13(2,3)17-12(20)18(4)16-7-8-5-9(14)6-10(15)11(8)19/h5-7,19H,1-4H3,(H,17,20)/b16-7+.
What are the key properties of 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea?
3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea has a molecular weight of 334.27 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylthiourea is sourced from PubChem (CID 135445518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).