C21H18F2N2O3S — CID 135445564
(2,4-difluorophenyl) 4-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanylmethyl]benzoate (PubChem CID 135445564) has the molecular formula C21H18F2N2O3S and a molecular weight of 416.45 g/mol. Its IUPAC name is (2,4-difluorophenyl) 4-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | (2,4-difluorophenyl) 4-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 135445564 |
| Molecular Formula | C21H18F2N2O3S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (2,4-difluorophenyl) 4-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanylmethyl]benzoate |
| SMILES | CCCc1cc(=O)[nH]c(SCc2ccc(C(=O)Oc3ccc(F)cc3F)cc2)n1 |
| InChI | InChI=1S/C21H18F2N2O3S/c1-2-3-16-11-19(26)25-21(24-16)29-12-13-4-6-14(7-5-13)20(27)28-18-9-8-15(22)10-17(18)23/h4-11H,2-3,12H2,1H3,(H,24,25,26) |
| InChIKey | KQFVRRAAGRPGGL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|