C38H34N4O6 — CID 135445910
5,15-bis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135445910) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is 5,15-bis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135445910 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 5,15-bis(3,4,5-trimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(-c2c3nc(cc4ccc([nH]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc(OC)c1OC |
| InChI | InChI=1S/C38H34N4O6/c1-43-31-15-21(16-32(44-2)37(31)47-5)35-27-11-7-23(39-27)19-25-9-13-29(41-25)36(22-17-33(45-3)38(48-6)34(18-22)46-4)30-14-10-26(42-30)20-24-8-12-28(35)40-24/h7-20,39,42H,1-6H3/b23-19-,24-20-,25-19-,26-20-,35-27-,35-28-,36-29-,36-30- |
| InChIKey | BNDKVIZDTGNNTO-RIRTYBNCSA-N |
| XLogP | 8.04 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |