C29H48N2O2 — CID 135446366
(NZ)-N-[(3E)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-3-hydroxyimino-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine (PubChem CID 135446366) has the molecular formula C29H48N2O2 and a molecular weight of 456.72 g/mol. Its IUPAC name is (NZ)-N-[(3E)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-3-hydroxyimino-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3E)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-3-hydroxyimino-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135446366 |
| Molecular Formula | C29H48N2O2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.37 |
| IUPAC Name | (NZ)-N-[(3E)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-3-hydroxyimino-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-ylidene]hydroxylamine |
| SMILES | CCC(CC[C@@H](C)C1CCC2C3C/C(=N/O)C4=C/C(=N/O)CCC4(C)C3CCC21C)C(C)C |
| InChI | InChI=1S/C29H48N2O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31-33)26-16-21(30-32)12-14-29(26,6)25(22)13-15-28(23,24)5/h16,18-20,22-25,32-33H,7-15,17H2,1-6H3/b30-21+,31-27-/t19-,20?,22?,23?,24?,25?,28?,29?/m1/s1 |
| InChIKey | KCQSWZLMFYKPDB-KXLPYFMNSA-N |
| XLogP | 7.93 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|