About 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one
2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one (PubChem CID 135446919) has the molecular formula C9H13N5O4
and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one |
| PubChem CID | 135446919 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2COCC(O)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-2-5(16)1-15/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) |
| InChIKey | YMJRISBBXAOKCD-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one?
The IUPAC name of 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one (CID 135446919) is 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one?
The canonical SMILES for 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one is Nc1nc2c(ncn2COCC(O)CO)c(=O)[nH]1.
What is the InChIKey of 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one?
The InChIKey is YMJRISBBXAOKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-2-5(16)1-15/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17).
What are the key properties of 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one?
2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one has a molecular weight of 255.23 g/mol, XLogP of -1.97, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(2,3-dihydroxypropoxymethyl)-1H-purin-6-one is sourced from PubChem (CID 135446919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).