C9H11N3O — CID 135447117
1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135447117) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135447117 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1,3,4-trimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1cc(=O)[nH]c2c1c(C)nn2C |
| InChI | InChI=1S/C9H11N3O/c1-5-4-7(13)10-9-8(5)6(2)11-12(9)3/h4H,1-3H3,(H,10,13) |
| InChIKey | CYLGJHAAHGAZHV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |