C20H21N5O3 — CID 135447428
methyl (2E)-2-[(2E)-1-(3,4-dimethylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxoimidazolidin-4-ylidene]acetate (PubChem CID 135447428) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl (2E)-2-[(2E)-1-(3,4-dimethylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxoimidazolidin-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2E)-1-(3,4-dimethylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxoimidazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 135447428 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | methyl (2E)-2-[(2E)-1-(3,4-dimethylphenyl)-2-(4,6-dimethylpyrimidin-2-yl)imino-5-oxoimidazolidin-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1/N/C(=N\c2nc(C)cc(C)n2)N(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C20H21N5O3/c1-11-6-7-15(8-12(11)2)25-18(27)16(10-17(26)28-5)23-20(25)24-19-21-13(3)9-14(4)22-19/h6-10H,1-5H3,(H,21,22,23,24)/b16-10+ |
| InChIKey | OWMRWDGXQKFWPW-MHWRWJLKSA-N |
| XLogP | 2.39 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|