C28H27N3O3S — CID 135447468
N-(3,4-dimethylphenyl)-2-[3-[[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 135447468) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-[[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-[[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 135447468 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-[[2-(2,3-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(C=C3S/C(=N\c4cccc(C)c4C)NC3=O)c2)cc1C |
| InChI | InChI=1S/C28H27N3O3S/c1-17-11-12-22(13-19(17)3)29-26(32)16-34-23-9-6-8-21(14-23)15-25-27(33)31-28(35-25)30-24-10-5-7-18(2)20(24)4/h5-15H,16H2,1-4H3,(H,29,32)(H,30,31,33) |
| InChIKey | XFWDTJOAZNAGOB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|