C21H23N5O2S2 — CID 135447490
3-[[5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 135447490) has the molecular formula C21H23N5O2S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-[[5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135447490 |
| Molecular Formula | C21H23N5O2S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-[[5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCc1cccc2c(C3=NN/C(=N/c4cccc(S(=O)(=O)N(C)C)c4)SC3)c[nH]c12 |
| InChI | InChI=1S/C21H23N5O2S2/c1-4-14-7-5-10-17-18(12-22-20(14)17)19-13-29-21(25-24-19)23-15-8-6-9-16(11-15)30(27,28)26(2)3/h5-12,22H,4,13H2,1-3H3,(H,23,25) |
| InChIKey | WHPVBXXPLGHPKD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|