C34H48CuN4O8 — CID 135447689
bis(2-tert-butyl-6-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-nitrophenol);copper (PubChem CID 135447689) has the molecular formula C34H48CuN4O8 and a molecular weight of 704.32 g/mol. Its IUPAC name is bis(2-tert-butyl-6-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-nitrophenol);copper.
| Compound Name | bis(2-tert-butyl-6-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-nitrophenol);copper |
|---|---|
| PubChem CID | 135447689 |
| Molecular Formula | C34H48CuN4O8 |
| Molecular Weight | 704.32 g/mol |
| Exact Mass | 703.28 |
| IUPAC Name | bis(2-tert-butyl-6-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-nitrophenol);copper |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])cc(C2=N[C@@H](C(C)(C)C)CO2)c1O.CC(C)(C)c1cc([N+](=O)[O-])cc(C2=N[C@@H](C(C)(C)C)CO2)c1O.[Cu] |
| InChI | InChI=1S/2C17H24N2O4.Cu/c2*1-16(2,3)12-8-10(19(21)22)7-11(14(12)20)15-18-13(9-23-15)17(4,5)6;/h2*7-8,13,20H,9H2,1-6H3;/t2*13-;/m11./s1 |
| InChIKey | LNCLDPGMAMESRJ-WFEKIRLUSA-N |
| XLogP | 7.58 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.32 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|