C22H17N3S — CID 135447778
(2Z)-2-[5-methyl-3-(4-methylphenyl)imino-1H-indol-2-ylidene]-2-thiophen-2-ylacetonitrile (PubChem CID 135447778) has the molecular formula C22H17N3S and a molecular weight of 355.47 g/mol. Its IUPAC name is (2Z)-2-[5-methyl-3-(4-methylphenyl)imino-1H-indol-2-ylidene]-2-thiophen-2-ylacetonitrile.
| Compound Name | (2Z)-2-[5-methyl-3-(4-methylphenyl)imino-1H-indol-2-ylidene]-2-thiophen-2-ylacetonitrile |
|---|---|
| PubChem CID | 135447778 |
| Molecular Formula | C22H17N3S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2Z)-2-[5-methyl-3-(4-methylphenyl)imino-1H-indol-2-ylidene]-2-thiophen-2-ylacetonitrile |
| SMILES | Cc1ccc(/N=C2C(=C(\C#N)c3cccs3)/Nc3ccc(C)cc3/2)cc1 |
| InChI | InChI=1S/C22H17N3S/c1-14-5-8-16(9-6-14)24-21-17-12-15(2)7-10-19(17)25-22(21)18(13-23)20-4-3-11-26-20/h3-12,25H,1-2H3/b22-18-,24-21+ |
| InChIKey | NQQYVWKZJXXJMX-GCGFSECMSA-N |
| XLogP | 5.85 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|