C20H27N5O2 — CID 135448072
N-[N-butanoyl-N'-(4,6,8-trimethylquinazolin-2-yl)carbamimidoyl]butanamide (PubChem CID 135448072) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[N-butanoyl-N'-(4,6,8-trimethylquinazolin-2-yl)carbamimidoyl]butanamide.
| Compound Name | N-[N-butanoyl-N'-(4,6,8-trimethylquinazolin-2-yl)carbamimidoyl]butanamide |
|---|---|
| PubChem CID | 135448072 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[N-butanoyl-N'-(4,6,8-trimethylquinazolin-2-yl)carbamimidoyl]butanamide |
| SMILES | CCCC(=O)NC(=Nc1nc(C)c2cc(C)cc(C)c2n1)NC(=O)CCC |
| InChI | InChI=1S/C20H27N5O2/c1-6-8-16(26)22-20(23-17(27)9-7-2)25-19-21-14(5)15-11-12(3)10-13(4)18(15)24-19/h10-11H,6-9H2,1-5H3,(H2,21,22,23,24,25,26,27) |
| InChIKey | UFHAIWRJVBYFQU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|