C23H24N2O2 — CID 135448442
[(E)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 4-tert-butylbenzoate (PubChem CID 135448442) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [(E)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 4-tert-butylbenzoate.
| Compound Name | [(E)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 135448442 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [(E)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)O/N=C2\CCCc3[nH]c4ccccc4c32)cc1 |
| InChI | InChI=1S/C23H24N2O2/c1-23(2,3)16-13-11-15(12-14-16)22(26)27-25-20-10-6-9-19-21(20)17-7-4-5-8-18(17)24-19/h4-5,7-8,11-14,24H,6,9-10H2,1-3H3/b25-20+ |
| InChIKey | KEUVEDUKNQBHEC-LKUDQCMESA-N |
| XLogP | 5.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|