C17H14Cl2N2O — CID 135448473
2,4-dichloro-6-[(E)-[(E)-(3-methyl-2,3-dihydroinden-1-ylidene)hydrazinylidene]methyl]phenol (PubChem CID 135448473) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[(E)-(3-methyl-2,3-dihydroinden-1-ylidene)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-[(E)-(3-methyl-2,3-dihydroinden-1-ylidene)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135448473 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[(E)-(3-methyl-2,3-dihydroinden-1-ylidene)hydrazinylidene]methyl]phenol |
| SMILES | CC1C/C(=N\N=C\c2cc(Cl)cc(Cl)c2O)c2ccccc21 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-10-6-16(14-5-3-2-4-13(10)14)21-20-9-11-7-12(18)8-15(19)17(11)22/h2-5,7-10,22H,6H2,1H3/b20-9+,21-16+ |
| InChIKey | DEIJNYLNSAXKKD-KTOXEOKQSA-N |
| XLogP | 5.03 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|