C8H10N6O — CID 135448478
N'-hydroxy-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carboximidamide (PubChem CID 135448478) has the molecular formula C8H10N6O and a molecular weight of 206.21 g/mol. Its IUPAC name is N'-hydroxy-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carboximidamide.
| Compound Name | N'-hydroxy-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carboximidamide |
|---|---|
| PubChem CID | 135448478 |
| Molecular Formula | C8H10N6O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N'-hydroxy-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carboximidamide |
| SMILES | Cc1cc2nnc(/C(N)=N/O)c(C)n2n1 |
| InChI | InChI=1S/C8H10N6O/c1-4-3-6-10-11-7(8(9)13-15)5(2)14(6)12-4/h3,15H,1-2H3,(H2,9,13) |
| InChIKey | XLGVFXXATZXOPU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|