About 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one
9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 135448689) has the molecular formula C11H9N3O2
and a molecular weight of 215.21 g/mol. Its IUPAC name is 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one.
Molecular Properties
| Compound Name | 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one |
| PubChem CID | 135448689 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | COc1cccc2[nH]c3c(=O)[nH]cnc3c12 |
| InChI | InChI=1S/C11H9N3O2/c1-16-7-4-2-3-6-8(7)9-10(14-6)11(15)13-5-12-9/h2-5,14H,1H3,(H,12,13,15) |
| InChIKey | LQIHYZDCTRTCLG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one?
The IUPAC name of 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one (CID 135448689) is 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one.
What is the SMILES notation for 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one?
The canonical SMILES for 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one is COc1cccc2[nH]c3c(=O)[nH]cnc3c12.
What is the InChIKey of 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one?
The InChIKey is LQIHYZDCTRTCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2/c1-16-7-4-2-3-6-8(7)9-10(14-6)11(15)13-5-12-9/h2-5,14H,1H3,(H,12,13,15).
What are the key properties of 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one?
9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one has a molecular weight of 215.21 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-3,5-dihydropyrimido[5,4-b]indol-4-one is sourced from PubChem (CID 135448689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).